About 8,9-dimethylidenetricyclo[5.2.1.02,6]decane
8,9-dimethylidenetricyclo[5.2.1.02,6]decane (PubChem CID 15046958) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is 8,9-dimethylidenetricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | 8,9-dimethylidenetricyclo[5.2.1.02,6]decane |
| PubChem CID | 15046958 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | 8,9-dimethylidenetricyclo[5.2.1.02,6]decane |
| SMILES | C=C1C(=C)C2CC1C1CCCC21 |
| InChI | InChI=1S/C12H16/c1-7-8(2)12-6-11(7)9-4-3-5-10(9)12/h9-12H,1-6H2 |
| InChIKey | LKCZWRCYCVMLQE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 8,9-dimethylidenetricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dimethylidenetricyclo[5.2.1.02,6]decane?
The IUPAC name of 8,9-dimethylidenetricyclo[5.2.1.02,6]decane (CID 15046958) is 8,9-dimethylidenetricyclo[5.2.1.02,6]decane.
What is the SMILES notation for 8,9-dimethylidenetricyclo[5.2.1.02,6]decane?
The canonical SMILES for 8,9-dimethylidenetricyclo[5.2.1.02,6]decane is C=C1C(=C)C2CC1C1CCCC21.
What is the InChIKey of 8,9-dimethylidenetricyclo[5.2.1.02,6]decane?
The InChIKey is LKCZWRCYCVMLQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16/c1-7-8(2)12-6-11(7)9-4-3-5-10(9)12/h9-12H,1-6H2.
What are the key properties of 8,9-dimethylidenetricyclo[5.2.1.02,6]decane?
8,9-dimethylidenetricyclo[5.2.1.02,6]decane has a molecular weight of 160.26 g/mol, XLogP of 3.16, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dimethylidenetricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 15046958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).