About 4,4-diethoxy-2,2-diethyloxane
4,4-diethoxy-2,2-diethyloxane (PubChem CID 150470923) has the molecular formula C13H26O3
and a molecular weight of 230.35 g/mol. Its IUPAC name is 4,4-diethoxy-2,2-diethyloxane.
Molecular Properties
| Compound Name | 4,4-diethoxy-2,2-diethyloxane |
| PubChem CID | 150470923 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 4,4-diethoxy-2,2-diethyloxane |
| SMILES | CCOC1(OCC)CCOC(CC)(CC)C1 |
| InChI | InChI=1S/C13H26O3/c1-5-12(6-2)11-13(14-7-3,15-8-4)9-10-16-12/h5-11H2,1-4H3 |
| InChIKey | HRTVGELRYPKBIX-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4,4-diethoxy-2,2-diethyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-diethoxy-2,2-diethyloxane?
The IUPAC name of 4,4-diethoxy-2,2-diethyloxane (CID 150470923) is 4,4-diethoxy-2,2-diethyloxane.
What is the SMILES notation for 4,4-diethoxy-2,2-diethyloxane?
The canonical SMILES for 4,4-diethoxy-2,2-diethyloxane is CCOC1(OCC)CCOC(CC)(CC)C1.
What is the InChIKey of 4,4-diethoxy-2,2-diethyloxane?
The InChIKey is HRTVGELRYPKBIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O3/c1-5-12(6-2)11-13(14-7-3,15-8-4)9-10-16-12/h5-11H2,1-4H3.
What are the key properties of 4,4-diethoxy-2,2-diethyloxane?
4,4-diethoxy-2,2-diethyloxane has a molecular weight of 230.35 g/mol, XLogP of 3.12, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-diethoxy-2,2-diethyloxane is sourced from PubChem (CID 150470923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).