C84H126Si6 — CID 15047163
4-[2,3,4,5,6-pentakis[4-tri(propan-2-yl)silylbuta-1,3-diynyl]phenyl]buta-1,3-diynyl-tri(propan-2-yl)silane (PubChem CID 15047163) has the molecular formula C84H126Si6 and a molecular weight of 1304.45 g/mol. Its IUPAC name is 4-[2,3,4,5,6-pentakis[4-tri(propan-2-yl)silylbuta-1,3-diynyl]phenyl]buta-1,3-diynyl-tri(propan-2-yl)silane.
| Compound Name | 4-[2,3,4,5,6-pentakis[4-tri(propan-2-yl)silylbuta-1,3-diynyl]phenyl]buta-1,3-diynyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 15047163 |
| Molecular Formula | C84H126Si6 |
| Molecular Weight | 1304.45 g/mol |
| Exact Mass | 1302.85 |
| IUPAC Name | 4-[2,3,4,5,6-pentakis[4-tri(propan-2-yl)silylbuta-1,3-diynyl]phenyl]buta-1,3-diynyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C#CC#Cc1c(C#CC#C[Si](C(C)C)(C(C)C)C(C)C)c(C#CC#C[Si](C(C)C)(C(C)C)C(C)C)c(C#CC#C[Si](C(C)C)(C(C)C)C(C)C)c(C#CC#C[Si](C(C)C)(C(C)C)C(C)C)c1C#CC#C[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C84H126Si6/c1-61(2)85(62(3)4,63(5)6)55-43-37-49-79-80(50-38-44-56-86(64(7)8,65(9)10)66(11)12)82(52-40-46-58-88(70(19)20,71(21)22)72(23)24)84(54-42-48-60-90(76(31)32,77(33)34)78(35)36)83(53-41-47-59-89(73(25)26,74(27)28)75(29)30)81(79)51-39-45-57-87(67(13)14,68(15)16)69(17)18/h61-78H,1-36H3 |
| InChIKey | JYLNABYSZPDETM-UHFFFAOYSA-N |
| XLogP | 23.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1304.45 |
| LogP ≤ 5 | 23.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|