C22H46N4 — CID 150472106
1-N',1-N"-dicyclopentyl-1-N,2-N-dimethyldecane-1,1,1,2-tetramine (PubChem CID 150472106) has the molecular formula C22H46N4 and a molecular weight of 366.64 g/mol. Its IUPAC name is 1-N',1-N"-dicyclopentyl-1-N,2-N-dimethyldecane-1,1,1,2-tetramine.
| Compound Name | 1-N',1-N"-dicyclopentyl-1-N,2-N-dimethyldecane-1,1,1,2-tetramine |
|---|---|
| PubChem CID | 150472106 |
| Molecular Formula | C22H46N4 |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 366.37 |
| IUPAC Name | 1-N',1-N"-dicyclopentyl-1-N,2-N-dimethyldecane-1,1,1,2-tetramine |
| SMILES | CCCCCCCCC(NC)C(NC)(NC1CCCC1)NC1CCCC1 |
| InChI | InChI=1S/C22H46N4/c1-4-5-6-7-8-9-18-21(23-2)22(24-3,25-19-14-10-11-15-19)26-20-16-12-13-17-20/h19-21,23-26H,4-18H2,1-3H3 |
| InChIKey | HSABTTXAYMWKJQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|