About 4-methyl-N-[(1E,3E)-5-(4-methylphenyl)iminopenta-1,3-dienyl]aniline
4-methyl-N-[(1E,3E)-5-(4-methylphenyl)iminopenta-1,3-dienyl]aniline (PubChem CID 15047319) has the molecular formula C19H20N2
and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-methyl-N-[(1E,3E)-5-(4-methylphenyl)iminopenta-1,3-dienyl]aniline.
Molecular Properties
| Compound Name | 4-methyl-N-[(1E,3E)-5-(4-methylphenyl)iminopenta-1,3-dienyl]aniline |
| PubChem CID | 15047319 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 4-methyl-N-[(1E,3E)-5-(4-methylphenyl)iminopenta-1,3-dienyl]aniline |
| SMILES | Cc1ccc(/N=C/C=C/C=C/Nc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H20N2/c1-16-6-10-18(11-7-16)20-14-4-3-5-15-21-19-12-8-17(2)9-13-19/h3-15,20H,1-2H3/b5-3+,14-4+,21-15+ |
| InChIKey | RPCWKNRDTUHKRC-WBAJKMBDSA-N |
| XLogP | 5.19 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N-[(1E,3E)-5-(4-methylphenyl)iminopenta-1,3-dienyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-[(1E,3E)-5-(4-methylphenyl)iminopenta-1,3-dienyl]aniline?
The IUPAC name of 4-methyl-N-[(1E,3E)-5-(4-methylphenyl)iminopenta-1,3-dienyl]aniline (CID 15047319) is 4-methyl-N-[(1E,3E)-5-(4-methylphenyl)iminopenta-1,3-dienyl]aniline.
What is the SMILES notation for 4-methyl-N-[(1E,3E)-5-(4-methylphenyl)iminopenta-1,3-dienyl]aniline?
The canonical SMILES for 4-methyl-N-[(1E,3E)-5-(4-methylphenyl)iminopenta-1,3-dienyl]aniline is Cc1ccc(/N=C/C=C/C=C/Nc2ccc(C)cc2)cc1.
What is the InChIKey of 4-methyl-N-[(1E,3E)-5-(4-methylphenyl)iminopenta-1,3-dienyl]aniline?
The InChIKey is RPCWKNRDTUHKRC-WBAJKMBDSA-N. The full InChI is InChI=1S/C19H20N2/c1-16-6-10-18(11-7-16)20-14-4-3-5-15-21-19-12-8-17(2)9-13-19/h3-15,20H,1-2H3/b5-3+,14-4+,21-15+.
What are the key properties of 4-methyl-N-[(1E,3E)-5-(4-methylphenyl)iminopenta-1,3-dienyl]aniline?
4-methyl-N-[(1E,3E)-5-(4-methylphenyl)iminopenta-1,3-dienyl]aniline has a molecular weight of 276.38 g/mol, XLogP of 5.19, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-[(1E,3E)-5-(4-methylphenyl)iminopenta-1,3-dienyl]aniline is sourced from PubChem (CID 15047319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).