C12H9F3N4O3 — CID 150473714
2-methoxy-5-[5-(3,3,3-trifluoropropanoyl)tetrazol-1-yl]benzaldehyde (PubChem CID 150473714) has the molecular formula C12H9F3N4O3 and a molecular weight of 314.22 g/mol. Its IUPAC name is 2-methoxy-5-[5-(3,3,3-trifluoropropanoyl)tetrazol-1-yl]benzaldehyde.
| Compound Name | 2-methoxy-5-[5-(3,3,3-trifluoropropanoyl)tetrazol-1-yl]benzaldehyde |
|---|---|
| PubChem CID | 150473714 |
| Molecular Formula | C12H9F3N4O3 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-methoxy-5-[5-(3,3,3-trifluoropropanoyl)tetrazol-1-yl]benzaldehyde |
| SMILES | COc1ccc(-n2nnnc2C(=O)CC(F)(F)F)cc1C=O |
| InChI | InChI=1S/C12H9F3N4O3/c1-22-10-3-2-8(4-7(10)6-20)19-11(16-17-18-19)9(21)5-12(13,14)15/h2-4,6H,5H2,1H3 |
| InChIKey | HSITULDCJSTIKW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|