C26H30ClF3N4O3 — CID 150475351
1-[4-(2-chloro-3,4,5-trifluorophenyl)piperidin-1-yl]-2-[3-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-5,6-dihydro-4H-cyclopenta[d]pyrazol-1-yl]ethanone (PubChem CID 150475351) has the molecular formula C26H30ClF3N4O3 and a molecular weight of 539.00 g/mol. Its IUPAC name is 1-[4-(2-chloro-3,4,5-trifluorophenyl)piperidin-1-yl]-2-[3-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-5,6-dihydro-4H-cyclopenta[d]pyrazol-1-yl]ethanone.
| Compound Name | 1-[4-(2-chloro-3,4,5-trifluorophenyl)piperidin-1-yl]-2-[3-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-5,6-dihydro-4H-cyclopenta[d]pyrazol-1-yl]ethanone |
|---|---|
| PubChem CID | 150475351 |
| Molecular Formula | C26H30ClF3N4O3 |
| Molecular Weight | 539.00 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 1-[4-(2-chloro-3,4,5-trifluorophenyl)piperidin-1-yl]-2-[3-[(2R,6S)-2,6-dimethylmorpholine-4-carbonyl]-5,6-dihydro-4H-cyclopenta[d]pyrazol-1-yl]ethanone |
| SMILES | C[C@@H]1CN(C(=O)c2nn(CC(=O)N3CCC(c4cc(F)c(F)c(F)c4Cl)CC3)c3c2CCC3)C[C@H](C)O1 |
| InChI | InChI=1S/C26H30ClF3N4O3/c1-14-11-33(12-15(2)37-14)26(36)25-17-4-3-5-20(17)34(31-25)13-21(35)32-8-6-16(7-9-32)18-10-19(28)23(29)24(30)22(18)27/h10,14-16H,3-9,11-13H2,1-2H3/t14-,15+ |
| InChIKey | HSRBNOSTWKMSMN-GASCZTMLSA-N |
| XLogP | 4.10 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.00 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|