C20H30N6O6S — CID 150477861
N-[3-[bis(hydroxymethyl)amino]propyl]-5-(3-methylbutyl)-2-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]-1,3-thiazole-4-carboxamide (PubChem CID 150477861) has the molecular formula C20H30N6O6S and a molecular weight of 482.56 g/mol. Its IUPAC name is N-[3-[bis(hydroxymethyl)amino]propyl]-5-(3-methylbutyl)-2-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[3-[bis(hydroxymethyl)amino]propyl]-5-(3-methylbutyl)-2-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 150477861 |
| Molecular Formula | C20H30N6O6S |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | N-[3-[bis(hydroxymethyl)amino]propyl]-5-(3-methylbutyl)-2-[(1-methyl-4-nitropyrrole-2-carbonyl)amino]-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)CCc1sc(NC(=O)c2cc([N+](=O)[O-])cn2C)nc1C(=O)NCCCN(CO)CO |
| InChI | InChI=1S/C20H30N6O6S/c1-13(2)5-6-16-17(19(30)21-7-4-8-25(11-27)12-28)22-20(33-16)23-18(29)15-9-14(26(31)32)10-24(15)3/h9-10,13,27-28H,4-8,11-12H2,1-3H3,(H,21,30)(H,22,23,29) |
| InChIKey | HTEGTSAXBOODTF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 162.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|