About 4-butoxy-1,1,1-trifluorotridecane
4-butoxy-1,1,1-trifluorotridecane (PubChem CID 150478729) has the molecular formula C17H33F3O
and a molecular weight of 310.44 g/mol. Its IUPAC name is 4-butoxy-1,1,1-trifluorotridecane.
Molecular Properties
| Compound Name | 4-butoxy-1,1,1-trifluorotridecane |
| PubChem CID | 150478729 |
| Molecular Formula | C17H33F3O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | 4-butoxy-1,1,1-trifluorotridecane |
| SMILES | CCCCCCCCCC(CCC(F)(F)F)OCCCC |
| InChI | InChI=1S/C17H33F3O/c1-3-5-7-8-9-10-11-12-16(21-15-6-4-2)13-14-17(18,19)20/h16H,3-15H2,1-2H3 |
| InChIKey | HTIWYXLEIMHIRC-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-butoxy-1,1,1-trifluorotridecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butoxy-1,1,1-trifluorotridecane?
The IUPAC name of 4-butoxy-1,1,1-trifluorotridecane (CID 150478729) is 4-butoxy-1,1,1-trifluorotridecane.
What is the SMILES notation for 4-butoxy-1,1,1-trifluorotridecane?
The canonical SMILES for 4-butoxy-1,1,1-trifluorotridecane is CCCCCCCCCC(CCC(F)(F)F)OCCCC.
What is the InChIKey of 4-butoxy-1,1,1-trifluorotridecane?
The InChIKey is HTIWYXLEIMHIRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33F3O/c1-3-5-7-8-9-10-11-12-16(21-15-6-4-2)13-14-17(18,19)20/h16H,3-15H2,1-2H3.
What are the key properties of 4-butoxy-1,1,1-trifluorotridecane?
4-butoxy-1,1,1-trifluorotridecane has a molecular weight of 310.44 g/mol, XLogP of 6.65, 14 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butoxy-1,1,1-trifluorotridecane is sourced from PubChem (CID 150478729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).