C12H21F3S2 — CID 15047941
2-(1,1,1-trifluorooctan-2-yl)-1,3-dithiane (PubChem CID 15047941) has the molecular formula C12H21F3S2 and a molecular weight of 286.43 g/mol. Its IUPAC name is 2-(1,1,1-trifluorooctan-2-yl)-1,3-dithiane.
| Compound Name | 2-(1,1,1-trifluorooctan-2-yl)-1,3-dithiane |
|---|---|
| PubChem CID | 15047941 |
| Molecular Formula | C12H21F3S2 |
| Molecular Weight | 286.43 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 2-(1,1,1-trifluorooctan-2-yl)-1,3-dithiane |
| SMILES | CCCCCCC(C1SCCCS1)C(F)(F)F |
| InChI | InChI=1S/C12H21F3S2/c1-2-3-4-5-7-10(12(13,14)15)11-16-8-6-9-17-11/h10-11H,2-9H2,1H3 |
| InChIKey | POUCLLLSUUYBAR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.43 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|