About 3-propan-2-ylthiazepine
3-propan-2-ylthiazepine (PubChem CID 150480106) has the molecular formula C8H11NS
and a molecular weight of 153.25 g/mol. Its IUPAC name is 3-propan-2-ylthiazepine.
Molecular Properties
| Compound Name | 3-propan-2-ylthiazepine |
| PubChem CID | 150480106 |
| Molecular Formula | C8H11NS |
| Molecular Weight | 153.25 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 3-propan-2-ylthiazepine |
| SMILES | CC(C)C1=NSC=CC=C1 |
| InChI | InChI=1S/C8H11NS/c1-7(2)8-5-3-4-6-10-9-8/h3-7H,1-2H3 |
| InChIKey | HTQILMYKISDIIH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-propan-2-ylthiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-ylthiazepine?
The IUPAC name of 3-propan-2-ylthiazepine (CID 150480106) is 3-propan-2-ylthiazepine.
What is the SMILES notation for 3-propan-2-ylthiazepine?
The canonical SMILES for 3-propan-2-ylthiazepine is CC(C)C1=NSC=CC=C1.
What is the InChIKey of 3-propan-2-ylthiazepine?
The InChIKey is HTQILMYKISDIIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NS/c1-7(2)8-5-3-4-6-10-9-8/h3-7H,1-2H3.
What are the key properties of 3-propan-2-ylthiazepine?
3-propan-2-ylthiazepine has a molecular weight of 153.25 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-ylthiazepine is sourced from PubChem (CID 150480106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).