C7H11F3N4 — CID 150480683
4-(1,1,1-trifluoropropan-2-yl)-1H-pyrimidine-4,6-diamine (PubChem CID 150480683) has the molecular formula C7H11F3N4 and a molecular weight of 208.19 g/mol. Its IUPAC name is 4-(1,1,1-trifluoropropan-2-yl)-1H-pyrimidine-4,6-diamine.
| Compound Name | 4-(1,1,1-trifluoropropan-2-yl)-1H-pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 150480683 |
| Molecular Formula | C7H11F3N4 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 4-(1,1,1-trifluoropropan-2-yl)-1H-pyrimidine-4,6-diamine |
| SMILES | CC(C(F)(F)F)C1(N)C=C(N)NC=N1 |
| InChI | InChI=1S/C7H11F3N4/c1-4(7(8,9)10)6(12)2-5(11)13-3-14-6/h2-4H,11-12H2,1H3,(H,13,14) |
| InChIKey | HTTFNPAOERNONA-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |