C43H42N2O8 — CID 15048130
tetramethyl 1-(1-methyl-2,3,6-triphenylpiperidin-4-yl)-2-phenyl-2H-pyridine-3,4,5,6-tetracarboxylate (PubChem CID 15048130) has the molecular formula C43H42N2O8 and a molecular weight of 714.82 g/mol. Its IUPAC name is tetramethyl 1-(1-methyl-2,3,6-triphenylpiperidin-4-yl)-2-phenyl-2H-pyridine-3,4,5,6-tetracarboxylate.
| Compound Name | tetramethyl 1-(1-methyl-2,3,6-triphenylpiperidin-4-yl)-2-phenyl-2H-pyridine-3,4,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 15048130 |
| Molecular Formula | C43H42N2O8 |
| Molecular Weight | 714.82 g/mol |
| Exact Mass | 714.29 |
| IUPAC Name | tetramethyl 1-(1-methyl-2,3,6-triphenylpiperidin-4-yl)-2-phenyl-2H-pyridine-3,4,5,6-tetracarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)C(c2ccccc2)N(C2CC(c3ccccc3)N(C)C(c3ccccc3)C2c2ccccc2)C(C(=O)OC)=C1C(=O)OC |
| InChI | InChI=1S/C43H42N2O8/c1-44-31(27-18-10-6-11-19-27)26-32(33(28-20-12-7-13-21-28)37(44)29-22-14-8-15-23-29)45-38(30-24-16-9-17-25-30)35(41(47)51-3)34(40(46)50-2)36(42(48)52-4)39(45)43(49)53-5/h6-25,31-33,37-38H,26H2,1-5H3 |
| InChIKey | FEHFAUKVIFZMIV-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.82 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|