About N-ethenyl-2-hexyl-3,5-dimethylindol-2-amine
N-ethenyl-2-hexyl-3,5-dimethylindol-2-amine (PubChem CID 150482198) has the molecular formula C18H26N2
and a molecular weight of 270.42 g/mol. Its IUPAC name is N-ethenyl-2-hexyl-3,5-dimethylindol-2-amine.
Molecular Properties
| Compound Name | N-ethenyl-2-hexyl-3,5-dimethylindol-2-amine |
| PubChem CID | 150482198 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | N-ethenyl-2-hexyl-3,5-dimethylindol-2-amine |
| SMILES | C=CNC1(CCCCCC)N=c2ccc(C)cc2=C1C |
| InChI | InChI=1S/C18H26N2/c1-5-7-8-9-12-18(19-6-2)15(4)16-13-14(3)10-11-17(16)20-18/h6,10-11,13,19H,2,5,7-9,12H2,1,3-4H3 |
| InChIKey | HUBAYXSLILJCAD-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-2-hexyl-3,5-dimethylindol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-2-hexyl-3,5-dimethylindol-2-amine?
The IUPAC name of N-ethenyl-2-hexyl-3,5-dimethylindol-2-amine (CID 150482198) is N-ethenyl-2-hexyl-3,5-dimethylindol-2-amine.
What is the SMILES notation for N-ethenyl-2-hexyl-3,5-dimethylindol-2-amine?
The canonical SMILES for N-ethenyl-2-hexyl-3,5-dimethylindol-2-amine is C=CNC1(CCCCCC)N=c2ccc(C)cc2=C1C.
What is the InChIKey of N-ethenyl-2-hexyl-3,5-dimethylindol-2-amine?
The InChIKey is HUBAYXSLILJCAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H26N2/c1-5-7-8-9-12-18(19-6-2)15(4)16-13-14(3)10-11-17(16)20-18/h6,10-11,13,19H,2,5,7-9,12H2,1,3-4H3.
What are the key properties of N-ethenyl-2-hexyl-3,5-dimethylindol-2-amine?
N-ethenyl-2-hexyl-3,5-dimethylindol-2-amine has a molecular weight of 270.42 g/mol, XLogP of 3.20, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-2-hexyl-3,5-dimethylindol-2-amine is sourced from PubChem (CID 150482198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).