C13H13NO4S — CID 150482230
5-(benzenesulfonyl)-4-ethyl-6-hydroxy-1H-pyridin-2-one (PubChem CID 150482230) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-4-ethyl-6-hydroxy-1H-pyridin-2-one.
| Compound Name | 5-(benzenesulfonyl)-4-ethyl-6-hydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 150482230 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 5-(benzenesulfonyl)-4-ethyl-6-hydroxy-1H-pyridin-2-one |
| SMILES | CCc1cc(=O)[nH]c(O)c1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H13NO4S/c1-2-9-8-11(15)14-13(16)12(9)19(17,18)10-6-4-3-5-7-10/h3-8H,2H2,1H3,(H2,14,15,16) |
| InChIKey | HUBFYWWHZIKYLM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 87.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |