C21H25N5O2 — CID 15048289
2-benzyl-5-morpholin-4-yl-2,4,6,7-tetrazatricyclo[7.5.0.03,7]tetradeca-1(9),3,5-trien-8-one (PubChem CID 15048289) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is 2-benzyl-5-morpholin-4-yl-2,4,6,7-tetrazatricyclo[7.5.0.03,7]tetradeca-1(9),3,5-trien-8-one.
| Compound Name | 2-benzyl-5-morpholin-4-yl-2,4,6,7-tetrazatricyclo[7.5.0.03,7]tetradeca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 15048289 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | 2-benzyl-5-morpholin-4-yl-2,4,6,7-tetrazatricyclo[7.5.0.03,7]tetradeca-1(9),3,5-trien-8-one |
| SMILES | O=c1c2c(n(Cc3ccccc3)c3nc(N4CCOCC4)nn13)CCCCC2 |
| InChI | InChI=1S/C21H25N5O2/c27-19-17-9-5-2-6-10-18(17)25(15-16-7-3-1-4-8-16)21-22-20(23-26(19)21)24-11-13-28-14-12-24/h1,3-4,7-8H,2,5-6,9-15H2 |
| InChIKey | NOEXBBUMRAYNLD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 64.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |