C19H19N5O5 — CID 15048379
ethyl (9E)-6-methyl-9-[(E)-(3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate (PubChem CID 15048379) has the molecular formula C19H19N5O5 and a molecular weight of 397.39 g/mol. Its IUPAC name is ethyl (9E)-6-methyl-9-[(E)-(3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate.
| Compound Name | ethyl (9E)-6-methyl-9-[(E)-(3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate |
|---|---|
| PubChem CID | 15048379 |
| Molecular Formula | C19H19N5O5 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | ethyl (9E)-6-methyl-9-[(E)-(3-nitrophenyl)methylidenehydrazinylidene]-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc2n(c1=O)C(C)CC/C2=N\N=C\c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19N5O5/c1-3-29-19(26)15-11-20-17-16(8-7-12(2)23(17)18(15)25)22-21-10-13-5-4-6-14(9-13)24(27)28/h4-6,9-12H,3,7-8H2,1-2H3/b21-10+,22-16+ |
| InChIKey | ATMYWKLKXHFGNL-RQALOGEDSA-N |
| XLogP | 2.51 |
| TPSA | 129.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|