C12H26N6 — CID 150484580
4-(2,2-dimethylpropyl)-6-N-[2-(methylamino)ethyl]-1H-pyrimidine-2,4,6-triamine (PubChem CID 150484580) has the molecular formula C12H26N6 and a molecular weight of 254.38 g/mol. Its IUPAC name is 4-(2,2-dimethylpropyl)-6-N-[2-(methylamino)ethyl]-1H-pyrimidine-2,4,6-triamine.
| Compound Name | 4-(2,2-dimethylpropyl)-6-N-[2-(methylamino)ethyl]-1H-pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 150484580 |
| Molecular Formula | C12H26N6 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.22 |
| IUPAC Name | 4-(2,2-dimethylpropyl)-6-N-[2-(methylamino)ethyl]-1H-pyrimidine-2,4,6-triamine |
| SMILES | CNCCNC1=CC(N)(CC(C)(C)C)N=C(N)N1 |
| InChI | InChI=1S/C12H26N6/c1-11(2,3)8-12(14)7-9(16-6-5-15-4)17-10(13)18-12/h7,15-16H,5-6,8,14H2,1-4H3,(H3,13,17,18) |
| InChIKey | HUNMXAYTHILXFX-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|