C18H23N3O — CID 15048547
N-(3-ethoxypropyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-amine (PubChem CID 15048547) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-amine.
| Compound Name | N-(3-ethoxypropyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-amine |
|---|---|
| PubChem CID | 15048547 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | N-(3-ethoxypropyl)-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2(7),3,5,11,13-hexaen-6-amine |
| SMILES | CCOCCCNc1ncnc2c1CCCc1ccccc1-2 |
| InChI | InChI=1S/C18H23N3O/c1-2-22-12-6-11-19-18-16-10-5-8-14-7-3-4-9-15(14)17(16)20-13-21-18/h3-4,7,9,13H,2,5-6,8,10-12H2,1H3,(H,19,20,21) |
| InChIKey | ZDWFNEHEVFPDRT-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|