C20H25NO2 — CID 15048617
3-[2-hydroxy-3-(4-phenylpiperidin-1-yl)propyl]phenol (PubChem CID 15048617) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 3-[2-hydroxy-3-(4-phenylpiperidin-1-yl)propyl]phenol.
| Compound Name | 3-[2-hydroxy-3-(4-phenylpiperidin-1-yl)propyl]phenol |
|---|---|
| PubChem CID | 15048617 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 3-[2-hydroxy-3-(4-phenylpiperidin-1-yl)propyl]phenol |
| SMILES | Oc1cccc(CC(O)CN2CCC(c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C20H25NO2/c22-19-8-4-5-16(13-19)14-20(23)15-21-11-9-18(10-12-21)17-6-2-1-3-7-17/h1-8,13,18,20,22-23H,9-12,14-15H2 |
| InChIKey | GJYBBFYCFSQQJJ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |