C26H21ClN6O — CID 150489345
[3-[2-[2-[(6-chloropyrido[3,2-d]pyrimidin-4-yl)amino]phenyl]ethynyl]phenyl]-piperazin-1-ylmethanone (PubChem CID 150489345) has the molecular formula C26H21ClN6O and a molecular weight of 468.95 g/mol. Its IUPAC name is [3-[2-[2-[(6-chloropyrido[3,2-d]pyrimidin-4-yl)amino]phenyl]ethynyl]phenyl]-piperazin-1-ylmethanone.
| Compound Name | [3-[2-[2-[(6-chloropyrido[3,2-d]pyrimidin-4-yl)amino]phenyl]ethynyl]phenyl]-piperazin-1-ylmethanone |
|---|---|
| PubChem CID | 150489345 |
| Molecular Formula | C26H21ClN6O |
| Molecular Weight | 468.95 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | [3-[2-[2-[(6-chloropyrido[3,2-d]pyrimidin-4-yl)amino]phenyl]ethynyl]phenyl]-piperazin-1-ylmethanone |
| SMILES | O=C(c1cccc(C#Cc2ccccc2Nc2ncnc3ccc(Cl)nc23)c1)N1CCNCC1 |
| InChI | InChI=1S/C26H21ClN6O/c27-23-11-10-22-24(32-23)25(30-17-29-22)31-21-7-2-1-5-19(21)9-8-18-4-3-6-20(16-18)26(34)33-14-12-28-13-15-33/h1-7,10-11,16-17,28H,12-15H2,(H,29,30,31) |
| InChIKey | HVLWEFRZOIVUMI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.95 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|