About 6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile
6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile (PubChem CID 15049002) has the molecular formula C14H11N3
and a molecular weight of 221.26 g/mol. Its IUPAC name is 6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile.
Molecular Properties
| Compound Name | 6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile |
| PubChem CID | 15049002 |
| Molecular Formula | C14H11N3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)CCC(n1ccnc1)=C2 |
| InChI | InChI=1S/C14H11N3/c15-9-11-1-2-13-8-14(4-3-12(13)7-11)17-6-5-16-10-17/h1-2,5-8,10H,3-4H2 |
| InChIKey | FJVRBJBZDWTUKQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile?
The IUPAC name of 6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile (CID 15049002) is 6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile.
What is the SMILES notation for 6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile?
The canonical SMILES for 6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile is N#Cc1ccc2c(c1)CCC(n1ccnc1)=C2.
What is the InChIKey of 6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile?
The InChIKey is FJVRBJBZDWTUKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11N3/c15-9-11-1-2-13-8-14(4-3-12(13)7-11)17-6-5-16-10-17/h1-2,5-8,10H,3-4H2.
What are the key properties of 6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile?
6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile has a molecular weight of 221.26 g/mol, XLogP of 2.70, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-imidazol-1-yl-7,8-dihydronaphthalene-2-carbonitrile is sourced from PubChem (CID 15049002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).