C14H19N5S — CID 150493806
4-amino-3-[4-(dimethylamino)-4-phenylbut-3-enyl]-1H-1,2,4-triazole-5-thione (PubChem CID 150493806) has the molecular formula C14H19N5S and a molecular weight of 289.41 g/mol. Its IUPAC name is 4-amino-3-[4-(dimethylamino)-4-phenylbut-3-enyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-amino-3-[4-(dimethylamino)-4-phenylbut-3-enyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 150493806 |
| Molecular Formula | C14H19N5S |
| Molecular Weight | 289.41 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 4-amino-3-[4-(dimethylamino)-4-phenylbut-3-enyl]-1H-1,2,4-triazole-5-thione |
| SMILES | CN(C)C(=CCCc1n[nH]c(=S)n1N)c1ccccc1 |
| InChI | InChI=1S/C14H19N5S/c1-18(2)12(11-7-4-3-5-8-11)9-6-10-13-16-17-14(20)19(13)15/h3-5,7-9H,6,10,15H2,1-2H3,(H,17,20) |
| InChIKey | HWIWIPROHSFCOY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 62.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|