About 2-(1H-azirin-2-yl)-1,3,5-triazine
2-(1H-azirin-2-yl)-1,3,5-triazine (PubChem CID 150494203) has the molecular formula C5H4N4
and a molecular weight of 120.11 g/mol. Its IUPAC name is 2-(1H-azirin-2-yl)-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-(1H-azirin-2-yl)-1,3,5-triazine |
| PubChem CID | 150494203 |
| Molecular Formula | C5H4N4 |
| Molecular Weight | 120.11 g/mol |
| Exact Mass | 120.04 |
| IUPAC Name | 2-(1H-azirin-2-yl)-1,3,5-triazine |
| SMILES | C1=C(c2ncncn2)N1 |
| InChI | InChI=1S/C5H4N4/c1-4(7-1)5-8-2-6-3-9-5/h1-3,7H |
| InChIKey | HWKXPQATBXDKGA-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.11 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1H-azirin-2-yl)-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-azirin-2-yl)-1,3,5-triazine?
The IUPAC name of 2-(1H-azirin-2-yl)-1,3,5-triazine (CID 150494203) is 2-(1H-azirin-2-yl)-1,3,5-triazine.
What is the SMILES notation for 2-(1H-azirin-2-yl)-1,3,5-triazine?
The canonical SMILES for 2-(1H-azirin-2-yl)-1,3,5-triazine is C1=C(c2ncncn2)N1.
What is the InChIKey of 2-(1H-azirin-2-yl)-1,3,5-triazine?
The InChIKey is HWKXPQATBXDKGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N4/c1-4(7-1)5-8-2-6-3-9-5/h1-3,7H.
What are the key properties of 2-(1H-azirin-2-yl)-1,3,5-triazine?
2-(1H-azirin-2-yl)-1,3,5-triazine has a molecular weight of 120.11 g/mol, XLogP of -0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-azirin-2-yl)-1,3,5-triazine is sourced from PubChem (CID 150494203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).