About [1-[4,5-diamino-2-(1H-indazol-6-ylcarbamoyl)phenyl]piperidin-4-yl]carbamic acid
[1-[4,5-diamino-2-(1H-indazol-6-ylcarbamoyl)phenyl]piperidin-4-yl]carbamic acid (PubChem CID 150497606) has the molecular formula C20H23N7O3
and a molecular weight of 409.45 g/mol. Its IUPAC name is [1-[4,5-diamino-2-(1H-indazol-6-ylcarbamoyl)phenyl]piperidin-4-yl]carbamic acid.
Molecular Properties
| Compound Name | [1-[4,5-diamino-2-(1H-indazol-6-ylcarbamoyl)phenyl]piperidin-4-yl]carbamic acid |
| PubChem CID | 150497606 |
| Molecular Formula | C20H23N7O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [1-[4,5-diamino-2-(1H-indazol-6-ylcarbamoyl)phenyl]piperidin-4-yl]carbamic acid |
| SMILES | Nc1cc(C(=O)Nc2ccc3cn[nH]c3c2)c(N2CCC(NC(=O)O)CC2)cc1N |
| InChI | InChI=1S/C20H23N7O3/c21-15-8-14(19(28)24-13-2-1-11-10-23-26-17(11)7-13)18(9-16(15)22)27-5-3-12(4-6-27)25-20(29)30/h1-2,7-10,12,25H,3-6,21-22H2,(H,23,26)(H,24,28)(H,29,30) |
| InChIKey | HXDAZFOGLWWJST-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 162.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [1-[4,5-diamino-2-(1H-indazol-6-ylcarbamoyl)phenyl]piperidin-4-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4,5-diamino-2-(1H-indazol-6-ylcarbamoyl)phenyl]piperidin-4-yl]carbamic acid?
The IUPAC name of [1-[4,5-diamino-2-(1H-indazol-6-ylcarbamoyl)phenyl]piperidin-4-yl]carbamic acid (CID 150497606) is [1-[4,5-diamino-2-(1H-indazol-6-ylcarbamoyl)phenyl]piperidin-4-yl]carbamic acid.
What is the SMILES notation for [1-[4,5-diamino-2-(1H-indazol-6-ylcarbamoyl)phenyl]piperidin-4-yl]carbamic acid?
The canonical SMILES for [1-[4,5-diamino-2-(1H-indazol-6-ylcarbamoyl)phenyl]piperidin-4-yl]carbamic acid is Nc1cc(C(=O)Nc2ccc3cn[nH]c3c2)c(N2CCC(NC(=O)O)CC2)cc1N.
What is the InChIKey of [1-[4,5-diamino-2-(1H-indazol-6-ylcarbamoyl)phenyl]piperidin-4-yl]carbamic acid?
The InChIKey is HXDAZFOGLWWJST-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23N7O3/c21-15-8-14(19(28)24-13-2-1-11-10-23-26-17(11)7-13)18(9-16(15)22)27-5-3-12(4-6-27)25-20(29)30/h1-2,7-10,12,25H,3-6,21-22H2,(H,23,26)(H,24,28)(H,29,30).
What are the key properties of [1-[4,5-diamino-2-(1H-indazol-6-ylcarbamoyl)phenyl]piperidin-4-yl]carbamic acid?
[1-[4,5-diamino-2-(1H-indazol-6-ylcarbamoyl)phenyl]piperidin-4-yl]carbamic acid has a molecular weight of 409.45 g/mol, XLogP of 2.22, 4 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4,5-diamino-2-(1H-indazol-6-ylcarbamoyl)phenyl]piperidin-4-yl]carbamic acid is sourced from PubChem (CID 150497606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).