C25H19Cl3N2O4 — CID 150498883
3-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2,4,6-trichlorobenzamide (PubChem CID 150498883) has the molecular formula C25H19Cl3N2O4 and a molecular weight of 517.80 g/mol. Its IUPAC name is 3-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2,4,6-trichlorobenzamide.
| Compound Name | 3-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2,4,6-trichlorobenzamide |
|---|---|
| PubChem CID | 150498883 |
| Molecular Formula | C25H19Cl3N2O4 |
| Molecular Weight | 517.80 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | 3-(1-amino-4b-hydroxy-10-oxo-7-propan-2-ylindeno[1,2-b][1]benzofuran-9b-yl)-2,4,6-trichlorobenzamide |
| SMILES | CC(C)c1ccc2c(c1)OC1(O)c3cccc(N)c3C(=O)C21c1c(Cl)cc(Cl)c(C(N)=O)c1Cl |
| InChI | InChI=1S/C25H19Cl3N2O4/c1-10(2)11-6-7-12-17(8-11)34-25(33)13-4-3-5-16(29)18(13)22(31)24(12,25)20-15(27)9-14(26)19(21(20)28)23(30)32/h3-10,33H,29H2,1-2H3,(H2,30,32) |
| InChIKey | HXJMUEDIOKJCFW-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.80 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|