C16H16N4OS2 — CID 15049904
2-benzyl-5-methylsulfanyl-11-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-trien-8-one (PubChem CID 15049904) has the molecular formula C16H16N4OS2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 2-benzyl-5-methylsulfanyl-11-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-trien-8-one.
| Compound Name | 2-benzyl-5-methylsulfanyl-11-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-trien-8-one |
|---|---|
| PubChem CID | 15049904 |
| Molecular Formula | C16H16N4OS2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 2-benzyl-5-methylsulfanyl-11-thia-2,4,6,7-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5-trien-8-one |
| SMILES | CSc1nc2n(Cc3ccccc3)c3c(c(=O)n2n1)CSCC3 |
| InChI | InChI=1S/C16H16N4OS2/c1-22-15-17-16-19(9-11-5-3-2-4-6-11)13-7-8-23-10-12(13)14(21)20(16)18-15/h2-6H,7-10H2,1H3 |
| InChIKey | MUEVNBYRMZTXRP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |