About 1-(4-methyl-1,3-thiazol-2-yl)-1-[3-(naphthalen-2-ylmethoxy)phenyl]propan-1-ol
1-(4-methyl-1,3-thiazol-2-yl)-1-[3-(naphthalen-2-ylmethoxy)phenyl]propan-1-ol (PubChem CID 15049997) has the molecular formula C24H23NO2S
and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-(4-methyl-1,3-thiazol-2-yl)-1-[3-(naphthalen-2-ylmethoxy)phenyl]propan-1-ol.
Molecular Properties
| Compound Name | 1-(4-methyl-1,3-thiazol-2-yl)-1-[3-(naphthalen-2-ylmethoxy)phenyl]propan-1-ol |
| PubChem CID | 15049997 |
| Molecular Formula | C24H23NO2S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 1-(4-methyl-1,3-thiazol-2-yl)-1-[3-(naphthalen-2-ylmethoxy)phenyl]propan-1-ol |
| SMILES | CCC(O)(c1cccc(OCc2ccc3ccccc3c2)c1)c1nc(C)cs1 |
| InChI | InChI=1S/C24H23NO2S/c1-3-24(26,23-25-17(2)16-28-23)21-9-6-10-22(14-21)27-15-18-11-12-19-7-4-5-8-20(19)13-18/h4-14,16,26H,3,15H2,1-2H3 |
| InChIKey | DQDPLVXAEUSMTM-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methyl-1,3-thiazol-2-yl)-1-[3-(naphthalen-2-ylmethoxy)phenyl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyl-1,3-thiazol-2-yl)-1-[3-(naphthalen-2-ylmethoxy)phenyl]propan-1-ol?
The IUPAC name of 1-(4-methyl-1,3-thiazol-2-yl)-1-[3-(naphthalen-2-ylmethoxy)phenyl]propan-1-ol (CID 15049997) is 1-(4-methyl-1,3-thiazol-2-yl)-1-[3-(naphthalen-2-ylmethoxy)phenyl]propan-1-ol.
What is the SMILES notation for 1-(4-methyl-1,3-thiazol-2-yl)-1-[3-(naphthalen-2-ylmethoxy)phenyl]propan-1-ol?
The canonical SMILES for 1-(4-methyl-1,3-thiazol-2-yl)-1-[3-(naphthalen-2-ylmethoxy)phenyl]propan-1-ol is CCC(O)(c1cccc(OCc2ccc3ccccc3c2)c1)c1nc(C)cs1.
What is the InChIKey of 1-(4-methyl-1,3-thiazol-2-yl)-1-[3-(naphthalen-2-ylmethoxy)phenyl]propan-1-ol?
The InChIKey is DQDPLVXAEUSMTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO2S/c1-3-24(26,23-25-17(2)16-28-23)21-9-6-10-22(14-21)27-15-18-11-12-19-7-4-5-8-20(19)13-18/h4-14,16,26H,3,15H2,1-2H3.
What are the key properties of 1-(4-methyl-1,3-thiazol-2-yl)-1-[3-(naphthalen-2-ylmethoxy)phenyl]propan-1-ol?
1-(4-methyl-1,3-thiazol-2-yl)-1-[3-(naphthalen-2-ylmethoxy)phenyl]propan-1-ol has a molecular weight of 389.52 g/mol, XLogP of 5.83, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyl-1,3-thiazol-2-yl)-1-[3-(naphthalen-2-ylmethoxy)phenyl]propan-1-ol is sourced from PubChem (CID 15049997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).