About trans-tert-butyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-pyridazin-3-ylethynyl)cyclohexane-1-carboxylate
trans-tert-butyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-pyridazin-3-ylethynyl)cyclohexane-1-carboxylate (PubChem CID 150501155) has the molecular formula C23H26N2O3
and a molecular weight of 378.47 g/mol. Its IUPAC name is trans-tert-butyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-pyridazin-3-ylethynyl)cyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | trans-tert-butyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-pyridazin-3-ylethynyl)cyclohexane-1-carboxylate |
| PubChem CID | 150501155 |
| Molecular Formula | C23H26N2O3 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | trans-tert-butyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-pyridazin-3-ylethynyl)cyclohexane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCC(O)(C#Cc2cccnn2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C23H26N2O3/c1-22(2,3)28-21(26)19-12-14-23(27,13-11-18-10-7-15-24-25-18)16-20(19)17-8-5-4-6-9-17/h4-10,15,19-20,27H,12,14,16H2,1-3H3/t19-,20+,23?/m1/s1 |
| InChIKey | HXVQGVHBNWMCPC-ZCQKWSGTSA-N |
| XLogP | 3.48 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trans-tert-butyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-pyridazin-3-ylethynyl)cyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-tert-butyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-pyridazin-3-ylethynyl)cyclohexane-1-carboxylate?
The IUPAC name of trans-tert-butyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-pyridazin-3-ylethynyl)cyclohexane-1-carboxylate (CID 150501155) is trans-tert-butyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-pyridazin-3-ylethynyl)cyclohexane-1-carboxylate.
What is the SMILES notation for trans-tert-butyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-pyridazin-3-ylethynyl)cyclohexane-1-carboxylate?
The canonical SMILES for trans-tert-butyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-pyridazin-3-ylethynyl)cyclohexane-1-carboxylate is CC(C)(C)OC(=O)[C@@H]1CCC(O)(C#Cc2cccnn2)C[C@H]1c1ccccc1.
What is the InChIKey of trans-tert-butyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-pyridazin-3-ylethynyl)cyclohexane-1-carboxylate?
The InChIKey is HXVQGVHBNWMCPC-ZCQKWSGTSA-N. The full InChI is InChI=1S/C23H26N2O3/c1-22(2,3)28-21(26)19-12-14-23(27,13-11-18-10-7-15-24-25-18)16-20(19)17-8-5-4-6-9-17/h4-10,15,19-20,27H,12,14,16H2,1-3H3/t19-,20+,23?/m1/s1.
What are the key properties of trans-tert-butyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-pyridazin-3-ylethynyl)cyclohexane-1-carboxylate?
trans-tert-butyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-pyridazin-3-ylethynyl)cyclohexane-1-carboxylate has a molecular weight of 378.47 g/mol, XLogP of 3.48, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for trans-tert-butyl (1R,2R)-4-hydroxy-2-phenyl-4-(2-pyridazin-3-ylethynyl)cyclohexane-1-carboxylate is sourced from PubChem (CID 150501155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).