C19H36O5 — CID 150503447
8-deuterio-8-hydroxy-2,2,14,14-tetramethylpentadecanedioic acid (PubChem CID 150503447) has the molecular formula C19H36O5 and a molecular weight of 345.50 g/mol. Its IUPAC name is 8-deuterio-8-hydroxy-2,2,14,14-tetramethylpentadecanedioic acid.
| Compound Name | 8-deuterio-8-hydroxy-2,2,14,14-tetramethylpentadecanedioic acid |
|---|---|
| PubChem CID | 150503447 |
| Molecular Formula | C19H36O5 |
| Molecular Weight | 345.50 g/mol |
| Exact Mass | 345.26 |
| IUPAC Name | 8-deuterio-8-hydroxy-2,2,14,14-tetramethylpentadecanedioic acid |
| SMILES | [2H]C(O)(CCCCCC(C)(C)C(=O)O)CCCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C19H36O5/c1-18(2,16(21)22)13-9-5-7-11-15(20)12-8-6-10-14-19(3,4)17(23)24/h15,20H,5-14H2,1-4H3,(H,21,22)(H,23,24)/i15D |
| InChIKey | HYHMLYSLQUKXKP-RWFJLFJASA-N |
| XLogP | 4.47 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|