About 4-(2-methylpropoxy)-1,3-dioxane
4-(2-methylpropoxy)-1,3-dioxane (PubChem CID 150506704) has the molecular formula C8H16O3
and a molecular weight of 160.21 g/mol. Its IUPAC name is 4-(2-methylpropoxy)-1,3-dioxane.
Molecular Properties
| Compound Name | 4-(2-methylpropoxy)-1,3-dioxane |
| PubChem CID | 150506704 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 4-(2-methylpropoxy)-1,3-dioxane |
| SMILES | CC(C)COC1CCOCO1 |
| InChI | InChI=1S/C8H16O3/c1-7(2)5-10-8-3-4-9-6-11-8/h7-8H,3-6H2,1-2H3 |
| InChIKey | HYYYUXKTPOALFP-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-methylpropoxy)-1,3-dioxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylpropoxy)-1,3-dioxane?
The IUPAC name of 4-(2-methylpropoxy)-1,3-dioxane (CID 150506704) is 4-(2-methylpropoxy)-1,3-dioxane.
What is the SMILES notation for 4-(2-methylpropoxy)-1,3-dioxane?
The canonical SMILES for 4-(2-methylpropoxy)-1,3-dioxane is CC(C)COC1CCOCO1.
What is the InChIKey of 4-(2-methylpropoxy)-1,3-dioxane?
The InChIKey is HYYYUXKTPOALFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3/c1-7(2)5-10-8-3-4-9-6-11-8/h7-8H,3-6H2,1-2H3.
What are the key properties of 4-(2-methylpropoxy)-1,3-dioxane?
4-(2-methylpropoxy)-1,3-dioxane has a molecular weight of 160.21 g/mol, XLogP of 1.38, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpropoxy)-1,3-dioxane is sourced from PubChem (CID 150506704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).