C10H17N5OS2 — CID 15050968
N-(2-methyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)-1,1-bis(methylsulfanyl)methanimine (PubChem CID 15050968) has the molecular formula C10H17N5OS2 and a molecular weight of 287.41 g/mol. Its IUPAC name is N-(2-methyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)-1,1-bis(methylsulfanyl)methanimine.
| Compound Name | N-(2-methyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)-1,1-bis(methylsulfanyl)methanimine |
|---|---|
| PubChem CID | 15050968 |
| Molecular Formula | C10H17N5OS2 |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | N-(2-methyl-5-morpholin-4-yl-1,2,4-triazol-3-yl)-1,1-bis(methylsulfanyl)methanimine |
| SMILES | CSC(=Nc1nc(N2CCOCC2)nn1C)SC |
| InChI | InChI=1S/C10H17N5OS2/c1-14-8(12-10(17-2)18-3)11-9(13-14)15-4-6-16-7-5-15/h4-7H2,1-3H3 |
| InChIKey | KCWUQHDZXIBOFS-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|