C9H16N4S3 — CID 15050983
1,1-bis(methylsulfanyl)-N-(5-methylsulfanyl-1-propyl-1,2,4-triazol-3-yl)methanimine (PubChem CID 15050983) has the molecular formula C9H16N4S3 and a molecular weight of 276.46 g/mol. Its IUPAC name is 1,1-bis(methylsulfanyl)-N-(5-methylsulfanyl-1-propyl-1,2,4-triazol-3-yl)methanimine.
| Compound Name | 1,1-bis(methylsulfanyl)-N-(5-methylsulfanyl-1-propyl-1,2,4-triazol-3-yl)methanimine |
|---|---|
| PubChem CID | 15050983 |
| Molecular Formula | C9H16N4S3 |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 1,1-bis(methylsulfanyl)-N-(5-methylsulfanyl-1-propyl-1,2,4-triazol-3-yl)methanimine |
| SMILES | CCCn1nc(N=C(SC)SC)nc1SC |
| InChI | InChI=1S/C9H16N4S3/c1-5-6-13-8(14-2)10-7(12-13)11-9(15-3)16-4/h5-6H2,1-4H3 |
| InChIKey | VAANVHMJWWSPLI-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|