About 5-(3-amino-4-anilinophenyl)pyrimidine-2,4-diamine
5-(3-amino-4-anilinophenyl)pyrimidine-2,4-diamine (PubChem CID 150510240) has the molecular formula C16H16N6
and a molecular weight of 292.35 g/mol. Its IUPAC name is 5-(3-amino-4-anilinophenyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 5-(3-amino-4-anilinophenyl)pyrimidine-2,4-diamine |
| PubChem CID | 150510240 |
| Molecular Formula | C16H16N6 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 5-(3-amino-4-anilinophenyl)pyrimidine-2,4-diamine |
| SMILES | Nc1ncc(-c2ccc(Nc3ccccc3)c(N)c2)c(N)n1 |
| InChI | InChI=1S/C16H16N6/c17-13-8-10(12-9-20-16(19)22-15(12)18)6-7-14(13)21-11-4-2-1-3-5-11/h1-9,21H,17H2,(H4,18,19,20,22) |
| InChIKey | HZRAYWJONNZEBM-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 115.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-(3-amino-4-anilinophenyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-amino-4-anilinophenyl)pyrimidine-2,4-diamine?
The IUPAC name of 5-(3-amino-4-anilinophenyl)pyrimidine-2,4-diamine (CID 150510240) is 5-(3-amino-4-anilinophenyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 5-(3-amino-4-anilinophenyl)pyrimidine-2,4-diamine?
The canonical SMILES for 5-(3-amino-4-anilinophenyl)pyrimidine-2,4-diamine is Nc1ncc(-c2ccc(Nc3ccccc3)c(N)c2)c(N)n1.
What is the InChIKey of 5-(3-amino-4-anilinophenyl)pyrimidine-2,4-diamine?
The InChIKey is HZRAYWJONNZEBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N6/c17-13-8-10(12-9-20-16(19)22-15(12)18)6-7-14(13)21-11-4-2-1-3-5-11/h1-9,21H,17H2,(H4,18,19,20,22).
What are the key properties of 5-(3-amino-4-anilinophenyl)pyrimidine-2,4-diamine?
5-(3-amino-4-anilinophenyl)pyrimidine-2,4-diamine has a molecular weight of 292.35 g/mol, XLogP of 2.63, 3 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-amino-4-anilinophenyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 150510240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).