C45H60O2S2 — CID 150512655
2-[[2-hydroxy-5-nonyl-3-[phenyl(sulfanyl)methyl]phenyl]methyl]-4-nonyl-6-[phenyl(sulfanyl)methyl]phenol (PubChem CID 150512655) has the molecular formula C45H60O2S2 and a molecular weight of 697.11 g/mol. Its IUPAC name is 2-[[2-hydroxy-5-nonyl-3-[phenyl(sulfanyl)methyl]phenyl]methyl]-4-nonyl-6-[phenyl(sulfanyl)methyl]phenol.
| Compound Name | 2-[[2-hydroxy-5-nonyl-3-[phenyl(sulfanyl)methyl]phenyl]methyl]-4-nonyl-6-[phenyl(sulfanyl)methyl]phenol |
|---|---|
| PubChem CID | 150512655 |
| Molecular Formula | C45H60O2S2 |
| Molecular Weight | 697.11 g/mol |
| Exact Mass | 696.40 |
| IUPAC Name | 2-[[2-hydroxy-5-nonyl-3-[phenyl(sulfanyl)methyl]phenyl]methyl]-4-nonyl-6-[phenyl(sulfanyl)methyl]phenol |
| SMILES | CCCCCCCCCc1cc(Cc2cc(CCCCCCCCC)cc(C(S)c3ccccc3)c2O)c(O)c(C(S)c2ccccc2)c1 |
| InChI | InChI=1S/C45H60O2S2/c1-3-5-7-9-11-13-17-23-34-29-38(42(46)40(31-34)44(48)36-25-19-15-20-26-36)33-39-30-35(24-18-14-12-10-8-6-4-2)32-41(43(39)47)45(49)37-27-21-16-22-28-37/h15-16,19-22,25-32,44-49H,3-14,17-18,23-24,33H2,1-2H3 |
| InChIKey | IAEKHJIQEZGQSS-UHFFFAOYSA-N |
| XLogP | 13.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.11 |
| LogP ≤ 5 | 13.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|