About 1-(2,4-difluorobenzene-3-id-1-yl)-2,5-dimethylpyrrole;titanium
1-(2,4-difluorobenzene-3-id-1-yl)-2,5-dimethylpyrrole;titanium (PubChem CID 150512959) has the molecular formula C12H10F2NTi-
and a molecular weight of 254.08 g/mol. Its IUPAC name is 1-(2,4-difluorobenzene-3-id-1-yl)-2,5-dimethylpyrrole;titanium.
Molecular Properties
| Compound Name | 1-(2,4-difluorobenzene-3-id-1-yl)-2,5-dimethylpyrrole;titanium |
| PubChem CID | 150512959 |
| Molecular Formula | C12H10F2NTi- |
| Molecular Weight | 254.08 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 1-(2,4-difluorobenzene-3-id-1-yl)-2,5-dimethylpyrrole;titanium |
| SMILES | Cc1ccc(C)n1-c1ccc(F)[c-]c1F.[Ti] |
| InChI | InChI=1S/C12H10F2N.Ti/c1-8-3-4-9(2)15(8)12-6-5-10(13)7-11(12)14;/h3-6H,1-2H3;/q-1; |
| InChIKey | UJPFXMQTTADFFX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.08 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,4-difluorobenzene-3-id-1-yl)-2,5-dimethylpyrrole;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,4-difluorobenzene-3-id-1-yl)-2,5-dimethylpyrrole;titanium?
The IUPAC name of 1-(2,4-difluorobenzene-3-id-1-yl)-2,5-dimethylpyrrole;titanium (CID 150512959) is 1-(2,4-difluorobenzene-3-id-1-yl)-2,5-dimethylpyrrole;titanium.
What is the SMILES notation for 1-(2,4-difluorobenzene-3-id-1-yl)-2,5-dimethylpyrrole;titanium?
The canonical SMILES for 1-(2,4-difluorobenzene-3-id-1-yl)-2,5-dimethylpyrrole;titanium is Cc1ccc(C)n1-c1ccc(F)[c-]c1F.[Ti].
What is the InChIKey of 1-(2,4-difluorobenzene-3-id-1-yl)-2,5-dimethylpyrrole;titanium?
The InChIKey is UJPFXMQTTADFFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F2N.Ti/c1-8-3-4-9(2)15(8)12-6-5-10(13)7-11(12)14;/h3-6H,1-2H3;/q-1;.
What are the key properties of 1-(2,4-difluorobenzene-3-id-1-yl)-2,5-dimethylpyrrole;titanium?
1-(2,4-difluorobenzene-3-id-1-yl)-2,5-dimethylpyrrole;titanium has a molecular weight of 254.08 g/mol, XLogP of 3.17, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,4-difluorobenzene-3-id-1-yl)-2,5-dimethylpyrrole;titanium is sourced from PubChem (CID 150512959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).