About 4,5-dichloro-3,6-dioctoxybenzene-1,2-dicarbonitrile
4,5-dichloro-3,6-dioctoxybenzene-1,2-dicarbonitrile (PubChem CID 15051316) has the molecular formula C24H34Cl2N2O2
and a molecular weight of 453.45 g/mol. Its IUPAC name is 4,5-dichloro-3,6-dioctoxybenzene-1,2-dicarbonitrile.
Molecular Properties
| Compound Name | 4,5-dichloro-3,6-dioctoxybenzene-1,2-dicarbonitrile |
| PubChem CID | 15051316 |
| Molecular Formula | C24H34Cl2N2O2 |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 4,5-dichloro-3,6-dioctoxybenzene-1,2-dicarbonitrile |
| SMILES | CCCCCCCCOc1c(Cl)c(Cl)c(OCCCCCCCC)c(C#N)c1C#N |
| InChI | InChI=1S/C24H34Cl2N2O2/c1-3-5-7-9-11-13-15-29-23-19(17-27)20(18-28)24(22(26)21(23)25)30-16-14-12-10-8-6-4-2/h3-16H2,1-2H3 |
| InChIKey | ADNIGSJDCQWOMU-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dichloro-3,6-dioctoxybenzene-1,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-3,6-dioctoxybenzene-1,2-dicarbonitrile?
The IUPAC name of 4,5-dichloro-3,6-dioctoxybenzene-1,2-dicarbonitrile (CID 15051316) is 4,5-dichloro-3,6-dioctoxybenzene-1,2-dicarbonitrile.
What is the SMILES notation for 4,5-dichloro-3,6-dioctoxybenzene-1,2-dicarbonitrile?
The canonical SMILES for 4,5-dichloro-3,6-dioctoxybenzene-1,2-dicarbonitrile is CCCCCCCCOc1c(Cl)c(Cl)c(OCCCCCCCC)c(C#N)c1C#N.
What is the InChIKey of 4,5-dichloro-3,6-dioctoxybenzene-1,2-dicarbonitrile?
The InChIKey is ADNIGSJDCQWOMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H34Cl2N2O2/c1-3-5-7-9-11-13-15-29-23-19(17-27)20(18-28)24(22(26)21(23)25)30-16-14-12-10-8-6-4-2/h3-16H2,1-2H3.
What are the key properties of 4,5-dichloro-3,6-dioctoxybenzene-1,2-dicarbonitrile?
4,5-dichloro-3,6-dioctoxybenzene-1,2-dicarbonitrile has a molecular weight of 453.45 g/mol, XLogP of 8.22, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-3,6-dioctoxybenzene-1,2-dicarbonitrile is sourced from PubChem (CID 15051316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).