C17H24N2 — CID 150513996
4-[(6-amino-1,5-dimethylcyclohexa-2,4-dien-1-yl)methyl]-2,6-dimethylaniline (PubChem CID 150513996) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 4-[(6-amino-1,5-dimethylcyclohexa-2,4-dien-1-yl)methyl]-2,6-dimethylaniline.
| Compound Name | 4-[(6-amino-1,5-dimethylcyclohexa-2,4-dien-1-yl)methyl]-2,6-dimethylaniline |
|---|---|
| PubChem CID | 150513996 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 4-[(6-amino-1,5-dimethylcyclohexa-2,4-dien-1-yl)methyl]-2,6-dimethylaniline |
| SMILES | CC1=CC=CC(C)(Cc2cc(C)c(N)c(C)c2)C1N |
| InChI | InChI=1S/C17H24N2/c1-11-6-5-7-17(4,16(11)19)10-14-8-12(2)15(18)13(3)9-14/h5-9,16H,10,18-19H2,1-4H3 |
| InChIKey | IALFHNSWTNGKGB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|