C7H4F9NO — CID 15051445
1,1,1,5,5,5-hexafluoro-4-(2,2,2-trifluoroethylimino)pentan-2-one (PubChem CID 15051445) has the molecular formula C7H4F9NO and a molecular weight of 289.10 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-4-(2,2,2-trifluoroethylimino)pentan-2-one.
| Compound Name | 1,1,1,5,5,5-hexafluoro-4-(2,2,2-trifluoroethylimino)pentan-2-one |
|---|---|
| PubChem CID | 15051445 |
| Molecular Formula | C7H4F9NO |
| Molecular Weight | 289.10 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-4-(2,2,2-trifluoroethylimino)pentan-2-one |
| SMILES | O=C(C/C(=N\CC(F)(F)F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H4F9NO/c8-5(9,10)2-17-3(6(11,12)13)1-4(18)7(14,15)16/h1-2H2/b17-3+ |
| InChIKey | WYCFMUUVADBLQW-IJUHEHPCSA-N |
| XLogP | 3.07 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.10 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|