C8H4F11NO — CID 15051446
1,1,1,2,2,6,6,6-octafluoro-5-(2,2,2-trifluoroethylimino)hexan-3-one (PubChem CID 15051446) has the molecular formula C8H4F11NO and a molecular weight of 339.10 g/mol. Its IUPAC name is 1,1,1,2,2,6,6,6-octafluoro-5-(2,2,2-trifluoroethylimino)hexan-3-one.
| Compound Name | 1,1,1,2,2,6,6,6-octafluoro-5-(2,2,2-trifluoroethylimino)hexan-3-one |
|---|---|
| PubChem CID | 15051446 |
| Molecular Formula | C8H4F11NO |
| Molecular Weight | 339.10 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | 1,1,1,2,2,6,6,6-octafluoro-5-(2,2,2-trifluoroethylimino)hexan-3-one |
| SMILES | O=C(C/C(=N/CC(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H4F11NO/c9-5(10,11)2-20-3(7(14,15)16)1-4(21)6(12,13)8(17,18)19/h1-2H2/b20-3- |
| InChIKey | QARLZRKHYULCER-DYUKFFQPSA-N |
| XLogP | 3.71 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.10 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|