C9H4F13NO — CID 15051447
1,1,1,2,2,3,3,7,7,7-decafluoro-6-(2,2,2-trifluoroethylimino)heptan-4-one (PubChem CID 15051447) has the molecular formula C9H4F13NO and a molecular weight of 389.11 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,7,7,7-decafluoro-6-(2,2,2-trifluoroethylimino)heptan-4-one.
| Compound Name | 1,1,1,2,2,3,3,7,7,7-decafluoro-6-(2,2,2-trifluoroethylimino)heptan-4-one |
|---|---|
| PubChem CID | 15051447 |
| Molecular Formula | C9H4F13NO |
| Molecular Weight | 389.11 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 1,1,1,2,2,3,3,7,7,7-decafluoro-6-(2,2,2-trifluoroethylimino)heptan-4-one |
| SMILES | O=C(C/C(=N/CC(F)(F)F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H4F13NO/c10-5(11,12)2-23-3(7(15,16)17)1-4(24)6(13,14)8(18,19)9(20,21)22/h1-2H2/b23-3- |
| InChIKey | PXDCHNLGLIPENI-LNQJRUQSSA-N |
| XLogP | 4.34 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.11 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|