C17H28N2O2S — CID 150518304
N,N-dibutyl-5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide (PubChem CID 150518304) has the molecular formula C17H28N2O2S and a molecular weight of 324.49 g/mol. Its IUPAC name is N,N-dibutyl-5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide.
| Compound Name | N,N-dibutyl-5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 150518304 |
| Molecular Formula | C17H28N2O2S |
| Molecular Weight | 324.49 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | N,N-dibutyl-5-cyano-1,6-dimethylcyclohexa-2,4-diene-1-sulfonamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)C1(C)C=CC=C(C#N)C1C |
| InChI | InChI=1S/C17H28N2O2S/c1-5-7-12-19(13-8-6-2)22(20,21)17(4)11-9-10-16(14-18)15(17)3/h9-11,15H,5-8,12-13H2,1-4H3 |
| InChIKey | IBGZNRNMZUIKED-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.49 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |