cyclohex-2-ene-1,2-dicarboxylic acid

C8H10O4 — CID 15051956

IUPACcyclohex-2-ene-1,2-dicarboxylic acid
SMILESO=C(O)C1=CCCCC1C(=O)O
InChIInChI=1S/C8H10O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h3,6H,1-2,4H2,(H,9,10)(H,11,12)
InChIKeyQDKOFCUUXIAICD-UHFFFAOYSA-N
MW170.16 g/mol
LogP0.88
Rot. Bonds2

About cyclohex-2-ene-1,2-dicarboxylic acid

cyclohex-2-ene-1,2-dicarboxylic acid (PubChem CID 15051956) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is cyclohex-2-ene-1,2-dicarboxylic acid.

Molecular Properties

Compound Namecyclohex-2-ene-1,2-dicarboxylic acid
PubChem CID15051956
Molecular FormulaC8H10O4
Molecular Weight170.16 g/mol
Exact Mass170.06
IUPAC Namecyclohex-2-ene-1,2-dicarboxylic acid
SMILESO=C(O)C1=CCCCC1C(=O)O
InChIInChI=1S/C8H10O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h3,6H,1-2,4H2,(H,9,10)(H,11,12)
InChIKeyQDKOFCUUXIAICD-UHFFFAOYSA-N
XLogP0.88
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.16
LogP ≤ 50.88
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze cyclohex-2-ene-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclohex-2-ene-1,2-dicarboxylic acid?
The IUPAC name of cyclohex-2-ene-1,2-dicarboxylic acid (CID 15051956) is cyclohex-2-ene-1,2-dicarboxylic acid.
What is the SMILES notation for cyclohex-2-ene-1,2-dicarboxylic acid?
The canonical SMILES for cyclohex-2-ene-1,2-dicarboxylic acid is O=C(O)C1=CCCCC1C(=O)O.
What is the InChIKey of cyclohex-2-ene-1,2-dicarboxylic acid?
The InChIKey is QDKOFCUUXIAICD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c9-7(10)5-3-1-2-4-6(5)8(11)12/h3,6H,1-2,4H2,(H,9,10)(H,11,12).
What are the key properties of cyclohex-2-ene-1,2-dicarboxylic acid?
cyclohex-2-ene-1,2-dicarboxylic acid has a molecular weight of 170.16 g/mol, XLogP of 0.88, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohex-2-ene-1,2-dicarboxylic acid is sourced from PubChem (CID 15051956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).