About 2-methoxysilyl-2,3-di(propan-2-yl)hexanoic acid
2-methoxysilyl-2,3-di(propan-2-yl)hexanoic acid (PubChem CID 150520715) has the molecular formula C13H28O3Si
and a molecular weight of 260.45 g/mol. Its IUPAC name is 2-methoxysilyl-2,3-di(propan-2-yl)hexanoic acid.
Molecular Properties
| Compound Name | 2-methoxysilyl-2,3-di(propan-2-yl)hexanoic acid |
| PubChem CID | 150520715 |
| Molecular Formula | C13H28O3Si |
| Molecular Weight | 260.45 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2-methoxysilyl-2,3-di(propan-2-yl)hexanoic acid |
| SMILES | CCCC(C(C)C)C([SiH2]OC)(C(=O)O)C(C)C |
| InChI | InChI=1S/C13H28O3Si/c1-7-8-11(9(2)3)13(10(4)5,12(14)15)17-16-6/h9-11H,7-8,17H2,1-6H3,(H,14,15) |
| InChIKey | IBTUIAJGPQVWOQ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.45 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxysilyl-2,3-di(propan-2-yl)hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxysilyl-2,3-di(propan-2-yl)hexanoic acid?
The IUPAC name of 2-methoxysilyl-2,3-di(propan-2-yl)hexanoic acid (CID 150520715) is 2-methoxysilyl-2,3-di(propan-2-yl)hexanoic acid.
What is the SMILES notation for 2-methoxysilyl-2,3-di(propan-2-yl)hexanoic acid?
The canonical SMILES for 2-methoxysilyl-2,3-di(propan-2-yl)hexanoic acid is CCCC(C(C)C)C([SiH2]OC)(C(=O)O)C(C)C.
What is the InChIKey of 2-methoxysilyl-2,3-di(propan-2-yl)hexanoic acid?
The InChIKey is IBTUIAJGPQVWOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28O3Si/c1-7-8-11(9(2)3)13(10(4)5,12(14)15)17-16-6/h9-11H,7-8,17H2,1-6H3,(H,14,15).
What are the key properties of 2-methoxysilyl-2,3-di(propan-2-yl)hexanoic acid?
2-methoxysilyl-2,3-di(propan-2-yl)hexanoic acid has a molecular weight of 260.45 g/mol, XLogP of 2.69, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxysilyl-2,3-di(propan-2-yl)hexanoic acid is sourced from PubChem (CID 150520715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).