C25H24F4IN5O2 — CID 150522355
4-[3-amino-6-(3,3-difluoro-4-hydroxycyclohexyl)pyrazin-2-yl]-2-fluoro-N'-[(1S)-1-(3-fluoro-5-iodophenyl)-2-hydroxyethyl]benzenecarboximidamide (PubChem CID 150522355) has the molecular formula C25H24F4IN5O2 and a molecular weight of 629.40 g/mol. Its IUPAC name is 4-[3-amino-6-(3,3-difluoro-4-hydroxycyclohexyl)pyrazin-2-yl]-2-fluoro-N'-[(1S)-1-(3-fluoro-5-iodophenyl)-2-hydroxyethyl]benzenecarboximidamide.
| Compound Name | 4-[3-amino-6-(3,3-difluoro-4-hydroxycyclohexyl)pyrazin-2-yl]-2-fluoro-N'-[(1S)-1-(3-fluoro-5-iodophenyl)-2-hydroxyethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 150522355 |
| Molecular Formula | C25H24F4IN5O2 |
| Molecular Weight | 629.40 g/mol |
| Exact Mass | 629.09 |
| IUPAC Name | 4-[3-amino-6-(3,3-difluoro-4-hydroxycyclohexyl)pyrazin-2-yl]-2-fluoro-N'-[(1S)-1-(3-fluoro-5-iodophenyl)-2-hydroxyethyl]benzenecarboximidamide |
| SMILES | N/C(=N\[C@H](CO)c1cc(F)cc(I)c1)c1ccc(-c2nc(C3CCC(O)C(F)(F)C3)cnc2N)cc1F |
| InChI | InChI=1S/C25H24F4IN5O2/c26-15-5-14(6-16(30)8-15)20(11-36)35-23(31)17-3-1-12(7-18(17)27)22-24(32)33-10-19(34-22)13-2-4-21(37)25(28,29)9-13/h1,3,5-8,10,13,20-21,36-37H,2,4,9,11H2,(H2,31,35)(H2,32,33)/t13?,20-,21?/m1/s1 |
| InChIKey | ICCOBZJZUNNEMY-WKHMMBAISA-N |
| XLogP | 4.31 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.40 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|