C28H30F3N5O2S — CID 150523529
(1R,3S,5R)-5-methoxy-1-N-[[4-(5-methoxy-3-pyridinyl)phenyl]methyl]-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine (PubChem CID 150523529) has the molecular formula C28H30F3N5O2S and a molecular weight of 557.64 g/mol. Its IUPAC name is (1R,3S,5R)-5-methoxy-1-N-[[4-(5-methoxy-3-pyridinyl)phenyl]methyl]-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine.
| Compound Name | (1R,3S,5R)-5-methoxy-1-N-[[4-(5-methoxy-3-pyridinyl)phenyl]methyl]-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine |
|---|---|
| PubChem CID | 150523529 |
| Molecular Formula | C28H30F3N5O2S |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | (1R,3S,5R)-5-methoxy-1-N-[[4-(5-methoxy-3-pyridinyl)phenyl]methyl]-3-N-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]cyclohexane-1,3-diamine |
| SMILES | COc1cncc(-c2ccc(CN[C@@H]3C[C@H](Nc4ncnc5sc(CC(F)(F)F)cc45)C[C@H](OC)C3)cc2)c1 |
| InChI | InChI=1S/C28H30F3N5O2S/c1-37-22-9-20(33-13-17-3-5-18(6-4-17)19-7-23(38-2)15-32-14-19)8-21(10-22)36-26-25-11-24(12-28(29,30)31)39-27(25)35-16-34-26/h3-7,11,14-16,20-22,33H,8-10,12-13H2,1-2H3,(H,34,35,36)/t20-,21+,22-/m1/s1 |
| InChIKey | ICIIOZPFGKEWLC-BHIFYINESA-N |
| XLogP | 6.00 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |