C9H11ClO7P2 — CID 150524215
[9-(3-chloropropyl)-3-oxo-2,4-dioxa-3λ5-phosphabicyclo[3.3.1]nona-1(9),5,7-trien-3-yl] dihydrogen phosphate (PubChem CID 150524215) has the molecular formula C9H11ClO7P2 and a molecular weight of 328.58 g/mol. Its IUPAC name is [9-(3-chloropropyl)-3-oxo-2,4-dioxa-3λ5-phosphabicyclo[3.3.1]nona-1(9),5,7-trien-3-yl] dihydrogen phosphate.
| Compound Name | [9-(3-chloropropyl)-3-oxo-2,4-dioxa-3λ5-phosphabicyclo[3.3.1]nona-1(9),5,7-trien-3-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 150524215 |
| Molecular Formula | C9H11ClO7P2 |
| Molecular Weight | 328.58 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | [9-(3-chloropropyl)-3-oxo-2,4-dioxa-3λ5-phosphabicyclo[3.3.1]nona-1(9),5,7-trien-3-yl] dihydrogen phosphate |
| SMILES | O=P(O)(O)OP1(=O)Oc2cccc(c2CCCCl)O1 |
| InChI | InChI=1S/C9H11ClO7P2/c10-6-2-3-7-8-4-1-5-9(7)16-19(14,15-8)17-18(11,12)13/h1,4-5H,2-3,6H2,(H2,11,12,13) |
| InChIKey | ICLVNNBQPFIHCY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.58 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|