About S-[[5-(2-methylphenyl)-1H-imidazol-2-yl]] N,N-dimethylcarbamothioate
S-[[5-(2-methylphenyl)-1H-imidazol-2-yl]] N,N-dimethylcarbamothioate (PubChem CID 15052551) has the molecular formula C13H15N3OS
and a molecular weight of 261.35 g/mol. Its IUPAC name is S-[[5-(2-methylphenyl)-1H-imidazol-2-yl]] N,N-dimethylcarbamothioate.
Molecular Properties
| Compound Name | S-[[5-(2-methylphenyl)-1H-imidazol-2-yl]] N,N-dimethylcarbamothioate |
| PubChem CID | 15052551 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | S-[[5-(2-methylphenyl)-1H-imidazol-2-yl]] N,N-dimethylcarbamothioate |
| SMILES | Cc1ccccc1-c1cnc(SC(=O)N(C)C)[nH]1 |
| InChI | InChI=1S/C13H15N3OS/c1-9-6-4-5-7-10(9)11-8-14-12(15-11)18-13(17)16(2)3/h4-8H,1-3H3,(H,14,15) |
| InChIKey | FOGVCDSWPVHYDK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[[5-(2-methylphenyl)-1H-imidazol-2-yl]] N,N-dimethylcarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[[5-(2-methylphenyl)-1H-imidazol-2-yl]] N,N-dimethylcarbamothioate?
The IUPAC name of S-[[5-(2-methylphenyl)-1H-imidazol-2-yl]] N,N-dimethylcarbamothioate (CID 15052551) is S-[[5-(2-methylphenyl)-1H-imidazol-2-yl]] N,N-dimethylcarbamothioate.
What is the SMILES notation for S-[[5-(2-methylphenyl)-1H-imidazol-2-yl]] N,N-dimethylcarbamothioate?
The canonical SMILES for S-[[5-(2-methylphenyl)-1H-imidazol-2-yl]] N,N-dimethylcarbamothioate is Cc1ccccc1-c1cnc(SC(=O)N(C)C)[nH]1.
What is the InChIKey of S-[[5-(2-methylphenyl)-1H-imidazol-2-yl]] N,N-dimethylcarbamothioate?
The InChIKey is FOGVCDSWPVHYDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3OS/c1-9-6-4-5-7-10(9)11-8-14-12(15-11)18-13(17)16(2)3/h4-8H,1-3H3,(H,14,15).
What are the key properties of S-[[5-(2-methylphenyl)-1H-imidazol-2-yl]] N,N-dimethylcarbamothioate?
S-[[5-(2-methylphenyl)-1H-imidazol-2-yl]] N,N-dimethylcarbamothioate has a molecular weight of 261.35 g/mol, XLogP of 3.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[[5-(2-methylphenyl)-1H-imidazol-2-yl]] N,N-dimethylcarbamothioate is sourced from PubChem (CID 15052551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).