About (4,5-dichloro-2,3-dimethoxyphenyl)-(2-methylpyrazol-3-yl)methanone
(4,5-dichloro-2,3-dimethoxyphenyl)-(2-methylpyrazol-3-yl)methanone (PubChem CID 15052556) has the molecular formula C13H12Cl2N2O3
and a molecular weight of 315.16 g/mol. Its IUPAC name is (4,5-dichloro-2,3-dimethoxyphenyl)-(2-methylpyrazol-3-yl)methanone.
Molecular Properties
| Compound Name | (4,5-dichloro-2,3-dimethoxyphenyl)-(2-methylpyrazol-3-yl)methanone |
| PubChem CID | 15052556 |
| Molecular Formula | C13H12Cl2N2O3 |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | (4,5-dichloro-2,3-dimethoxyphenyl)-(2-methylpyrazol-3-yl)methanone |
| SMILES | COc1c(C(=O)c2ccnn2C)cc(Cl)c(Cl)c1OC |
| InChI | InChI=1S/C13H12Cl2N2O3/c1-17-9(4-5-16-17)11(18)7-6-8(14)10(15)13(20-3)12(7)19-2/h4-6H,1-3H3 |
| InChIKey | HCJWTPCZKRZWNP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4,5-dichloro-2,3-dimethoxyphenyl)-(2-methylpyrazol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dichloro-2,3-dimethoxyphenyl)-(2-methylpyrazol-3-yl)methanone?
The IUPAC name of (4,5-dichloro-2,3-dimethoxyphenyl)-(2-methylpyrazol-3-yl)methanone (CID 15052556) is (4,5-dichloro-2,3-dimethoxyphenyl)-(2-methylpyrazol-3-yl)methanone.
What is the SMILES notation for (4,5-dichloro-2,3-dimethoxyphenyl)-(2-methylpyrazol-3-yl)methanone?
The canonical SMILES for (4,5-dichloro-2,3-dimethoxyphenyl)-(2-methylpyrazol-3-yl)methanone is COc1c(C(=O)c2ccnn2C)cc(Cl)c(Cl)c1OC.
What is the InChIKey of (4,5-dichloro-2,3-dimethoxyphenyl)-(2-methylpyrazol-3-yl)methanone?
The InChIKey is HCJWTPCZKRZWNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12Cl2N2O3/c1-17-9(4-5-16-17)11(18)7-6-8(14)10(15)13(20-3)12(7)19-2/h4-6H,1-3H3.
What are the key properties of (4,5-dichloro-2,3-dimethoxyphenyl)-(2-methylpyrazol-3-yl)methanone?
(4,5-dichloro-2,3-dimethoxyphenyl)-(2-methylpyrazol-3-yl)methanone has a molecular weight of 315.16 g/mol, XLogP of 2.98, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dichloro-2,3-dimethoxyphenyl)-(2-methylpyrazol-3-yl)methanone is sourced from PubChem (CID 15052556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).