C27H30F3N9O2 — CID 150527923
2-tert-butyl-N-[(5S)-8-[4-[(1-methylpyrazol-3-yl)amino]-1,3,5-triazin-2-yl]-2-(2,2,2-trifluoroethyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-1,3-oxazole-4-carboxamide (PubChem CID 150527923) has the molecular formula C27H30F3N9O2 and a molecular weight of 569.59 g/mol. Its IUPAC name is 2-tert-butyl-N-[(5S)-8-[4-[(1-methylpyrazol-3-yl)amino]-1,3,5-triazin-2-yl]-2-(2,2,2-trifluoroethyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-1,3-oxazole-4-carboxamide.
| Compound Name | 2-tert-butyl-N-[(5S)-8-[4-[(1-methylpyrazol-3-yl)amino]-1,3,5-triazin-2-yl]-2-(2,2,2-trifluoroethyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 150527923 |
| Molecular Formula | C27H30F3N9O2 |
| Molecular Weight | 569.59 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | 2-tert-butyl-N-[(5S)-8-[4-[(1-methylpyrazol-3-yl)amino]-1,3,5-triazin-2-yl]-2-(2,2,2-trifluoroethyl)-1,3,4,5-tetrahydro-2-benzazepin-5-yl]-1,3-oxazole-4-carboxamide |
| SMILES | Cn1ccc(Nc2ncnc(-c3ccc4c(c3)CN(CC(F)(F)F)CC[C@@H]4NC(=O)c3coc(C(C)(C)C)n3)n2)n1 |
| InChI | InChI=1S/C27H30F3N9O2/c1-26(2,3)24-34-20(13-41-24)23(40)33-19-7-10-39(14-27(28,29)30)12-17-11-16(5-6-18(17)19)22-31-15-32-25(36-22)35-21-8-9-38(4)37-21/h5-6,8-9,11,13,15,19H,7,10,12,14H2,1-4H3,(H,33,40)(H,31,32,35,36,37)/t19-/m0/s1 |
| InChIKey | IDFKYRCTKKJYDJ-IBGZPJMESA-N |
| XLogP | 4.54 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.59 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |